Products 438217-37-9
CAS 438217-37-9 appears in our catalog under these names: 2-(4-Chlorophenyl)-3,6-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Chlorophenyl)-3,6-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-chlorophenyl)-3,6-dimethylquinoline-4-carboxylic acid (CAS 438217-37-9) is a chemical compound with the molecular formula C18H14ClNO2 and a molecular weight of 311.8 g/mol. IUPAC name: 2-(4-chlorophenyl)-3,6-dimethylquinoline-4-carboxylic acid. InChIKey: XPXUYIPAKAXFKX-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3,6-dimethylquinoline-4-carboxylic acid |
| InChIKey | XPXUYIPAKAXFKX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C(=C2C(=O)O)C)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)