Products 862647-93-6
CAS 862647-93-6 appears in our catalog under these names: 7-Chloro-3,8-dimethyl-2-phenylquinoline-4-carboxylic acid, 95%, 7-Chloro-3,8-dimethyl-2-phenylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
7-chloro-3,8-dimethyl-2-phenylquinoline-4-carboxylic acid (CAS 862647-93-6) is a chemical compound with the molecular formula C18H14ClNO2 and a molecular weight of 311.8 g/mol. IUPAC name: 7-chloro-3,8-dimethyl-2-phenylquinoline-4-carboxylic acid. InChIKey: ASDAJYBCQKUNCE-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 7-chloro-3,8-dimethyl-2-phenylquinoline-4-carboxylic acid |
| InChIKey | ASDAJYBCQKUNCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(C(=C2C(=O)O)C)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)