Products 897559-93-2
CAS 897559-93-2 appears in our catalog under these names: 6-Chloro-2-(2,5-dimethylphenyl)quinoline-4-carboxylic acid, 95%, 6-Chloro-2-(2,5-dimethylphenyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-chloro-2-(2,5-dimethylphenyl)quinoline-4-carboxylic acid (CAS 897559-93-2) is a chemical compound with the molecular formula C18H14ClNO2 and a molecular weight of 311.8 g/mol. IUPAC name: 6-chloro-2-(2,5-dimethylphenyl)quinoline-4-carboxylic acid. InChIKey: CWDKCVJDMLJKBU-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 6-chloro-2-(2,5-dimethylphenyl)quinoline-4-carboxylic acid |
| InChIKey | CWDKCVJDMLJKBU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)