CAS 492448-66-5 is the registry number for 2-(4-Chlorophenyl)-3,8-dimethylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-chlorophenyl)-3,8-dimethylquinoline-4-carboxylic acid (CAS 492448-66-5) is a chemical compound with the molecular formula C18H14ClNO2 and a molecular weight of 311.8 g/mol. IUPAC name: 2-(4-chlorophenyl)-3,8-dimethylquinoline-4-carboxylic acid. InChIKey: NLDCBIMIUMXLOF-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO2 |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | NLDCBIMIUMXLOF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(C(=N2)C3=CC=C(C=C3)Cl)C)C(=O)O |
Computed by PubChem (NCBI)