CAS 438220-91-8 is the registry number for 5-((3-Methyl-4-nitrophenoxy)methyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbaldehyde (CAS 438220-91-8) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. IUPAC name: 5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbaldehyde. InChIKey: MYDAKBBQNODKHF-UHFFFAOYSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbaldehyde |
| InChIKey | MYDAKBBQNODKHF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=CC=C(O2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)