Products 438475-19-5
CAS 438475-19-5 appears in our catalog under these names: 3-[(2,2,2-Trifluoroethoxy)methyl]benzoic acid, 95%, 3-((2,2,2-Trifluoroethoxy)methyl)benzoic acid, 95+%, 3-((2,2,2-Trifluoroethoxy)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
3-(2,2,2-trifluoroethoxymethyl)benzoic acid (CAS 438475-19-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxymethyl)benzoic acid. InChIKey: GQHFVAPINPEZPD-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxymethyl)benzoic acid |
| InChIKey | GQHFVAPINPEZPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COCC(F)(F)F |
Computed by PubChem (NCBI)