Products 439813-86-2
CAS 439813-86-2 is the registry number for 1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole. Offered by: Biosynth. Available pack sizes: 0,25g.
1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 439813-86-2) is a chemical compound with the molecular formula C16H20BNO2 and a molecular weight of 269.1 g/mol. IUPAC name: 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: SSGOKPWCHTUNIQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | SSGOKPWCHTUNIQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)