CAS 442159-34-4 is the registry number for Benzyl (2S,3R)-2,3-Dihydroxy-2-methylbutyrate. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Benzyl (2S,3R)-2,3-dihydroxy-2-methylbutanoate (CAS 442159-34-4) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: benzyl (2S,3R)-2,3-dihydroxy-2-methylbutanoate. InChIKey: QXJHVANPLATLCH-SKDRFNHKSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | benzyl (2S,3R)-2,3-dihydroxy-2-methylbutanoate |
| InChIKey | QXJHVANPLATLCH-SKDRFNHKSA-N |
| SMILES | C[C@H]([C@@](C)(C(=O)OCC1=CC=CC=C1)O)O |
Computed by PubChem (NCBI)