Products 442565-11-9
CAS 442565-11-9 is the registry number for N-(5-methylisoxazol-3-yl)(5-methyl-3-phenylisoxazol-4-yl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
5-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-phenyl-1,2-oxazole-4-carboxamide (CAS 442565-11-9) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 5-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: PEDRSXQFYAZEJY-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 5-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | PEDRSXQFYAZEJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=C(ON=C2C3=CC=CC=C3)C |
Computed by PubChem (NCBI)