CAS 4433-11-8 appears in our catalog under these names: 3,4-Dimethyl-1,1'-biphenyl, 98%, 3,4-Dimethyl-1,1'-biphenyl 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
1,2-dimethyl-4-phenylbenzene (CAS 4433-11-8) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1,2-dimethyl-4-phenylbenzene. InChIKey: CKENDVLIAVMNDW-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1,2-dimethyl-4-phenylbenzene |
| InChIKey | CKENDVLIAVMNDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)