CAS 4434-61-1 appears in our catalog under these names: Z–DL–Met–OH, N-Carbobenzoxy-DL-methionine, >98.0%(HPLC)(T), Cbz-DL-Met-OH 98%, Z-DL-Met-OH, 97%, 97%, Z-DL-Met-OH, 99.62%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 10g, 5g, 500g, 1 g, 100 g.
4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 4434-61-1) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FPKHNNQXKZMOJJ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FPKHNNQXKZMOJJ-UHFFFAOYSA-N |
| SMILES | CSCCC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)