Products 444003-01-4
CAS 444003-01-4 appears in our catalog under these names: 1-(4-Aminophenyl)piperidine-2,6-dione, 1-(4-Aminophenyl)piperidine-2,6-dione, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
1-(4-aminophenyl)piperidine-2,6-dione (CAS 444003-01-4) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 1-(4-aminophenyl)piperidine-2,6-dione. InChIKey: WREGJVIGNZMJOB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-(4-aminophenyl)piperidine-2,6-dione |
| InChIKey | WREGJVIGNZMJOB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)