CAS 444058-30-4 appears in our catalog under these names: 5-Benzoyl-1,3,6-trimethylpyrimidine-2,4(1H,3H)-dione, 97%, 5-Benzoyl-1,3,6-trimethyl-2,4(1H,3H)-pyrimidinedione, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-benzoyl-1,3,6-trimethylpyrimidine-2,4-dione (CAS 444058-30-4) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 5-benzoyl-1,3,6-trimethylpyrimidine-2,4-dione. InChIKey: YWUIFHYPUIILNG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 5-benzoyl-1,3,6-trimethylpyrimidine-2,4-dione |
| InChIKey | YWUIFHYPUIILNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=O)N1C)C)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)