Products 444607-92-5

CAS 444607-92-5 is the registry number for 1-tert-Butyl 2-methyl isoindoline-1,2-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 1,3-dihydroisoindole-1,2-dicarboxylate (CAS 444607-92-5) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 1,3-dihydroisoindole-1,2-dicarboxylate. InChIKey: QLEZOAKFXCPTTK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 1,3-dihydroisoindole-1,2-dicarboxylate
InChIKeyQLEZOAKFXCPTTK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1C2=CC=CC=C2CN1C(=O)OC

Computed by PubChem (NCBI)