Products 445002-75-5
CAS 445002-75-5 is the registry number for 2-(4-Bromo-2-formylphenoxy)-N-phenylacetamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(4-bromo-2-formylphenoxy)-N-phenylacetamide (CAS 445002-75-5) is a chemical compound with the molecular formula C15H12BrNO3 and a molecular weight of 334.16 g/mol. IUPAC name: 2-(4-bromo-2-formylphenoxy)-N-phenylacetamide. InChIKey: CZPQQRBCOIRMSX-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO3 |
|---|---|
| Molecular weight | 334.16 g/mol |
| IUPAC name | 2-(4-bromo-2-formylphenoxy)-N-phenylacetamide |
| InChIKey | CZPQQRBCOIRMSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)COC2=C(C=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)