CAS 497061-19-5 is the registry number for 2-(2-(N-(3-bromophenyl)carbamoyl)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[2-[(3-bromophenyl)carbamoyl]phenyl]acetic acid (CAS 497061-19-5) is a chemical compound with the molecular formula C15H12BrNO3 and a molecular weight of 334.16 g/mol. IUPAC name: 2-[2-[(3-bromophenyl)carbamoyl]phenyl]acetic acid. InChIKey: AEEHRAJZTHLHTH-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO3 |
|---|---|
| Molecular weight | 334.16 g/mol |
| IUPAC name | 2-[2-[(3-bromophenyl)carbamoyl]phenyl]acetic acid |
| InChIKey | AEEHRAJZTHLHTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)