CAS 445003-63-4 appears in our catalog under these names: 2–(3–cyanophenyl)–2–methylpropanoic acid, 2-(3-Cyanophenyl)-2-methylpropanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
2-(3-cyanophenyl)-2-methylpropanoic acid (CAS 445003-63-4) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(3-cyanophenyl)-2-methylpropanoic acid. InChIKey: RPYGNUJSGOMETM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(3-cyanophenyl)-2-methylpropanoic acid |
| InChIKey | RPYGNUJSGOMETM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC(=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)