Products 446-63-9
CAS 446-63-9 appears in our catalog under these names: 1-(3-bromophenyl)-2,2,2-trifluoroethanol, 1-(3-Bromophenyl)-2,2,2-trifluoroethanol, 97%, 1-(3-Bromophenyl)-2,2,2-trifluoroethanol, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 250mg, 1g, 100mg, 50mg.
1-(3-bromophenyl)-2,2,2-trifluoroethanol (CAS 446-63-9) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanol. InChIKey: YJAXYKDDEAMXAW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanol |
| InChIKey | YJAXYKDDEAMXAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)