Products 446-66-2
CAS 446-66-2 appears in our catalog under these names: 1-(4-Chlorophenyl)-2,2,2-trifluoroethanol, 95%, 1–(4–Chlorophenyl)–2,2,2–Trifluoroethanol, 1-(4-Chlorophenyl)-2,2,2-trifluoroethanol 95%, 1-(4-Chlorophenyl)-2,2,2-trifluoroethanol, 95%, 95%, 1-(4-Chlorophenyl)-2,2,2-trifluoroethanol, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.
1-(4-chlorophenyl)-2,2,2-trifluoroethanol (CAS 446-66-2) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: DONAZKZEGGHKRH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | DONAZKZEGGHKRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)