Products 447-44-9
CAS 447-44-9 appears in our catalog under these names: 4-Fluoro-1H-indazole-6-carboxylic acid, 97%, 97%, 4-fluoro-2H-indazole-6-carboxylic acid, 98%, 4-FLUORO-1H-INDAZOLE-6-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
4-fluoro-1H-indazole-6-carboxylic acid (CAS 447-44-9) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 4-fluoro-1H-indazole-6-carboxylic acid. InChIKey: UCNORABQJKZNGX-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 4-fluoro-1H-indazole-6-carboxylic acid |
| InChIKey | UCNORABQJKZNGX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)F)C(=O)O |
Computed by PubChem (NCBI)