Products 447418-99-7
CAS 447418-99-7 is the registry number for 6-Chloro-3-(hydroxymethyl)-4-isopropoxy-2-methylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3-(hydroxymethyl)-2-methyl-4-propan-2-yloxyisoquinolin-1-one (CAS 447418-99-7) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 281.73 g/mol. IUPAC name: 6-chloro-3-(hydroxymethyl)-2-methyl-4-propan-2-yloxyisoquinolin-1-one. InChIKey: IFTHIOWAPQKMRY-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO3 |
|---|---|
| Molecular weight | 281.73 g/mol |
| IUPAC name | 6-chloro-3-(hydroxymethyl)-2-methyl-4-propan-2-yloxyisoquinolin-1-one |
| InChIKey | IFTHIOWAPQKMRY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(N(C(=O)C2=C1C=C(C=C2)Cl)C)CO |
Computed by PubChem (NCBI)