CAS 447461-22-5 is the registry number for 4-Chloro-3,5-dimethylpicolinic Acid. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
4-chloro-3,5-dimethylpyridine-2-carboxylic acid (CAS 447461-22-5) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 4-chloro-3,5-dimethylpyridine-2-carboxylic acid. InChIKey: CKGRDASRXROABV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 4-chloro-3,5-dimethylpyridine-2-carboxylic acid |
| InChIKey | CKGRDASRXROABV-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1Cl)C)C(=O)O |
Computed by PubChem (NCBI)