Products 448211-45-8
CAS 448211-45-8 appears in our catalog under these names: 2-(1-Cycloocten-1-yl)-4，4，5，5-tetramethyl-1，3，2-dioxaborolane, 95+%, 95+%, 2-(1-Cycloocten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[(1Z)-cycloocten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 448211-45-8) is a chemical compound with the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. IUPAC name: 2-[(1Z)-cycloocten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BIQJRRXWPUZKCQ-ZRDIBKRKSA-N.
| Molecular formula | C14H25BO2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-[(1Z)-cycloocten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BIQJRRXWPUZKCQ-ZRDIBKRKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C/2=C/CCCCCC2 |
Computed by PubChem (NCBI)