Products 449155-88-8
CAS 449155-88-8 is the registry number for N-(4-Chloro-2-methylphenyl)-2-methoxybenzamide, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
N-(4-chloro-2-methylphenyl)-2-methoxybenzamide (CAS 449155-88-8) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: N-(4-chloro-2-methylphenyl)-2-methoxybenzamide. InChIKey: FRENLLHTOOXIPZ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | N-(4-chloro-2-methylphenyl)-2-methoxybenzamide |
| InChIKey | FRENLLHTOOXIPZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)NC(=O)C2=CC=CC=C2OC |
Computed by PubChem (NCBI)