CAS 4507-41-9 is the registry number for Methyl 2-amino-2-phenylpropanoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 2-amino-2-phenylpropanoate (CAS 4507-41-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-amino-2-phenylpropanoate. InChIKey: MPSVDCFUZLGFKX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 2-amino-2-phenylpropanoate |
| InChIKey | MPSVDCFUZLGFKX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C(=O)OC)N |
Computed by PubChem (NCBI)