CAS 4507-46-4 is the registry number for tert-Butyl 2-amino-2-phenylpropanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 2-amino-2-phenylpropanoate (CAS 4507-46-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl 2-amino-2-phenylpropanoate. InChIKey: SMFLSCJHGMOWSS-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | tert-butyl 2-amino-2-phenylpropanoate |
| InChIKey | SMFLSCJHGMOWSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)