Products 451460-00-7
CAS 451460-00-7 is the registry number for 3-Amino-3-(1h-indol-2-yl)propanoic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-amino-3-(1H-indol-2-yl)propanoic acid (CAS 451460-00-7) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-amino-3-(1H-indol-2-yl)propanoic acid. InChIKey: JPZWSQYPJFVDMA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-amino-3-(1H-indol-2-yl)propanoic acid |
| InChIKey | JPZWSQYPJFVDMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(CC(=O)O)N |
Computed by PubChem (NCBI)