CAS 4534-11-6 appears in our catalog under these names: 4-Isopropyl-3-methylaniline hydrochloride, 95% , 3-Methyl-4-isopropylaniline hydrochloride. Offered by: Thermo Scientific, Chemat. Available pack sizes: 10g, 2mg, 10mg.
3-methyl-4-propan-2-ylaniline;hydrochloride (CAS 4534-11-6) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: 3-methyl-4-propan-2-ylaniline;hydrochloride. InChIKey: VPOAQDSAPBSOLW-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | 3-methyl-4-propan-2-ylaniline;hydrochloride |
| InChIKey | VPOAQDSAPBSOLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C(C)C.Cl |
Computed by PubChem (NCBI)