CAS 457634-20-7 is the registry number for 4-((tert-Butoxycarbonyl)oxy)-2-methylphenol. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
Tert-butyl (4-hydroxy-3-methylphenyl) carbonate (CAS 457634-20-7) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: tert-butyl (4-hydroxy-3-methylphenyl) carbonate. InChIKey: DMXZOCUVVOPORJ-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | tert-butyl (4-hydroxy-3-methylphenyl) carbonate |
| InChIKey | DMXZOCUVVOPORJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)