Products 457940-87-3
CAS 457940-87-3 appears in our catalog under these names: Nek2/Hec1-IN-3, 98.05%, N-[4-(4-Methylphenyl)-2-thiazolyl]-2-pyridinecarboxamide, 95%, 95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 10 mg, 10mg, 25mg.
N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide (CAS 457940-87-3) is a chemical compound with the molecular formula C16H13N3OS and a molecular weight of 295.4 g/mol. IUPAC name: N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide. InChIKey: DAIASWMZQYEEEC-UHFFFAOYSA-N.
| Molecular formula | C16H13N3OS |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| InChIKey | DAIASWMZQYEEEC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)