CAS 4599-47-7 appears in our catalog under these names: DL-4-Methylphenylalanine, 97%, H–DL–Phe(4–Me)–OH, Phenylalanine, 4-methyl-, 98%, 98%, H-DL-Phe(4-Me)-OH, 99.74%, 2-Amino-3-p-tolyl-propionic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 10 g, 5 g, 1 g.
2-amino-3-(4-methylphenyl)propanoic acid (CAS 4599-47-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-amino-3-(4-methylphenyl)propanoic acid. InChIKey: DQLHSFUMICQIMB-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-amino-3-(4-methylphenyl)propanoic acid |
| InChIKey | DQLHSFUMICQIMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(C(=O)O)N |
Computed by PubChem (NCBI)