CAS 49759-61-7 appears in our catalog under these names: 4-Methyl-D-phenylalanine, 97%, H–D–Phe(4–Me)–OH, H-D-Phe(4-Me)-OH, 4-Methyl-D-phenylalanine, 98% , H-D-Phe(4-Me)-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg, 100 g, 5 g.
(2R)-2-amino-3-(4-methylphenyl)propanoic acid (CAS 49759-61-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-amino-3-(4-methylphenyl)propanoic acid. InChIKey: DQLHSFUMICQIMB-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-methylphenyl)propanoic acid |
| InChIKey | DQLHSFUMICQIMB-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)