CAS 460742-50-1 is the registry number for 3,5-Dichloro-α-methyl-α-phenylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-dichlorophenyl)-1-phenylethanol (CAS 460742-50-1) is a chemical compound with the molecular formula C14H12Cl2O and a molecular weight of 267.1 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-1-phenylethanol. InChIKey: ZCIRDADWEKEXDG-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O |
|---|---|
| Molecular weight | 267.1 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-1-phenylethanol |
| InChIKey | ZCIRDADWEKEXDG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)