CAS 56428-00-3 is the registry number for 4,4'-(oxybis(methylene))bis(chlorobenzene). Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene (CAS 56428-00-3) is a chemical compound with the molecular formula C14H12Cl2O and a molecular weight of 267.1 g/mol. IUPAC name: 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene. InChIKey: REXQTRHCVRPOMB-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O |
|---|---|
| Molecular weight | 267.1 g/mol |
| IUPAC name | 1-chloro-4-[(4-chlorophenyl)methoxymethyl]benzene |
| InChIKey | REXQTRHCVRPOMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COCC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)