Products 463941-20-0
CAS 463941-20-0 is the registry number for HCV-371. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1R)-5-cyano-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid (CAS 463941-20-0) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: 2-[(1R)-5-cyano-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid. InChIKey: JXZYSNWHGBGZAI-GOSISDBHSA-N.
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-[(1R)-5-cyano-8-methyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid |
| InChIKey | JXZYSNWHGBGZAI-GOSISDBHSA-N |
| SMILES | CCC[C@]1(C2=C(CCO1)C3=C(C=CC(=C3N2)C)C#N)CC(=O)O |
Computed by PubChem (NCBI)