CAS 4642-95-9 appears in our catalog under these names: Equilin Impurity 3,Trendione, Trendione. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg.
(8S,13S,14S)-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (CAS 4642-95-9) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: (8S,13S,14S)-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione. InChIKey: KBSXJBBFQODDTQ-RYRKJORJSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | (8S,13S,14S)-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | KBSXJBBFQODDTQ-RYRKJORJSA-N |
| SMILES | C[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CCC2=O |
Computed by PubChem (NCBI)