CAS 465546-82-1 is the registry number for 5-Benzyloxy-2-mercaptobenzimidazole. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
5-phenylmethoxy-1,3-dihydrobenzimidazole-2-thione (CAS 465546-82-1) is a chemical compound with the molecular formula C14H12N2OS and a molecular weight of 256.32 g/mol. IUPAC name: 5-phenylmethoxy-1,3-dihydrobenzimidazole-2-thione. InChIKey: URZVNGKRWWMOKB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 5-phenylmethoxy-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | URZVNGKRWWMOKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC(=S)N3 |
Computed by PubChem (NCBI)