Products 466678-47-7
CAS 466678-47-7 is the registry number for Pregabalin Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-(2-methylpropyl)-1-[[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one (CAS 466678-47-7) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (4S)-4-(2-methylpropyl)-1-[[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one. InChIKey: AZUXUOROLIYZMA-XASJZRDYSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (4S)-4-(2-methylpropyl)-1-[[(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one |
| InChIKey | AZUXUOROLIYZMA-XASJZRDYSA-N |
| SMILES | CC(C)C[C@H]1CC(=O)N(C1)C[C@]2([C@H]([C@H]([C@@H](CO2)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Pregabalin impurity 13, Pregabalin Impurity 198