Products 501666-22-4
CAS 501666-22-4 appears in our catalog under these names: Pregabalin Impurity 22, Pregabalin Impurity PD0310806, Pregabalin Impurity 16. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(4R)-4-(2-methylpropyl)-1-[[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one (CAS 501666-22-4) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (4R)-4-(2-methylpropyl)-1-[[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one. InChIKey: AZUXUOROLIYZMA-SJVBDLOYSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (4R)-4-(2-methylpropyl)-1-[[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one |
| InChIKey | AZUXUOROLIYZMA-SJVBDLOYSA-N |
| SMILES | CC(C)C[C@@H]1CC(=O)N(C1)C[C@@]2([C@H]([C@H]([C@@H](CO2)O)O)O)O |
Computed by PubChem (NCBI)