Products 46697-00-1
CAS 46697-00-1 appears in our catalog under these names: AC1Q3QWB, AC1Q3QWB, 99.39%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 5 mg, 10 mg, 100 mg, 10mM/1mL, 25 mg.
N-[(5,7-dichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-2-amine (CAS 46697-00-1) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: N-[(5,7-dichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-2-amine. InChIKey: FCFGRTQYVIIVRZ-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | N-[(5,7-dichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]propan-2-amine |
| InChIKey | FCFGRTQYVIIVRZ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1CC2=C(O1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)