Products 4670-29-5
CAS 4670-29-5 is the registry number for Alloptaeroxylin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5-hydroxy-2,8,8-trimethylpyrano[2,3-h]chromen-4-one (CAS 4670-29-5) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 5-hydroxy-2,8,8-trimethylpyrano[2,3-h]chromen-4-one. InChIKey: YQAACNBUDADMIV-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 5-hydroxy-2,8,8-trimethylpyrano[2,3-h]chromen-4-one |
| InChIKey | YQAACNBUDADMIV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C3=C(C=C2O)OC(C=C3)(C)C |
Computed by PubChem (NCBI)