CAS 469864-28-6 is the registry number for N-methoxy-N,2-dimethylpyridine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-methoxy-N,2-dimethylpyridine-3-carboxamide (CAS 469864-28-6) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: N-methoxy-N,2-dimethylpyridine-3-carboxamide. InChIKey: JJRHSKUSJZVDDQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | N-methoxy-N,2-dimethylpyridine-3-carboxamide |
| InChIKey | JJRHSKUSJZVDDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)C(=O)N(C)OC |
Computed by PubChem (NCBI)