Products 470666-16-1
CAS 470666-16-1 is the registry number for (6-methoxynaphthalen-2-yl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6-methoxynaphthalen-2-yl)-phenylmethanol (CAS 470666-16-1) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: (6-methoxynaphthalen-2-yl)-phenylmethanol. InChIKey: IPMKAFQJGDRVFA-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | (6-methoxynaphthalen-2-yl)-phenylmethanol |
| InChIKey | IPMKAFQJGDRVFA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)