CAS 47157-01-7 is the registry number for 2,6-Dibenzylphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibenzylphenol (CAS 47157-01-7) is a chemical compound with the molecular formula C20H18O and a molecular weight of 274.4 g/mol. IUPAC name: 2,6-dibenzylphenol. InChIKey: DUCSXVAAPCQAEP-UHFFFAOYSA-N.
| Molecular formula | C20H18O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2,6-dibenzylphenol |
| InChIKey | DUCSXVAAPCQAEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C(=CC=C2)CC3=CC=CC=C3)O |
Computed by PubChem (NCBI)