CAS 4722-81-0 appears in our catalog under these names: 5,6-Dimethoxy-1h-indole-2,3-dione, 95%, 5,6-Dimethoxyindoline-2,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
5,6-dimethoxy-1H-indole-2,3-dione (CAS 4722-81-0) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 5,6-dimethoxy-1H-indole-2,3-dione. InChIKey: HBNMEXSXIIAELS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 5,6-dimethoxy-1H-indole-2,3-dione |
| InChIKey | HBNMEXSXIIAELS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=O)N2)OC |
Computed by PubChem (NCBI)