Products 473-37-0

CAS 473-37-0 is the registry number for Edrophonium chloride Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide (CAS 473-37-0) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: ethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide. InChIKey: CXTOKLCLMGHMRU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO2
Molecular weight183.25 g/mol
IUPAC nameethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide
InChIKeyCXTOKLCLMGHMRU-UHFFFAOYSA-N
SMILESCC[N+](C)(C)C1=CC(=CC=C1)O.[OH-]

Computed by PubChem (NCBI)