CAS 473-37-0 is the registry number for Edrophonium chloride Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide (CAS 473-37-0) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: ethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide. InChIKey: CXTOKLCLMGHMRU-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | ethyl-(3-hydroxyphenyl)-dimethylazanium hydroxide |
| InChIKey | CXTOKLCLMGHMRU-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(C)C1=CC(=CC=C1)O.[OH-] |
Computed by PubChem (NCBI)