CAS 473-72-3 appears in our catalog under these names: Cis-pinonic acid, 95%, Pinonic Acid. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 10g, 5g, 500mg, 25g.
2-(3-acetyl-2,2-dimethylcyclobutyl)acetic acid (CAS 473-72-3) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 2-(3-acetyl-2,2-dimethylcyclobutyl)acetic acid. InChIKey: SIZDUQQDBXJXLQ-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 2-(3-acetyl-2,2-dimethylcyclobutyl)acetic acid |
| InChIKey | SIZDUQQDBXJXLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC(C1(C)C)CC(=O)O |
Computed by PubChem (NCBI)