CAS 52305-34-7 is the registry number for 2-((1R,3R)-3-acetyl-2,2-dimethylcyclobutyl)acetic acid, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
2-[(1R,3R)-3-acetyl-2,2-dimethylcyclobutyl]acetic acid (CAS 52305-34-7) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 2-[(1R,3R)-3-acetyl-2,2-dimethylcyclobutyl]acetic acid. InChIKey: SIZDUQQDBXJXLQ-SFYZADRCSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 2-[(1R,3R)-3-acetyl-2,2-dimethylcyclobutyl]acetic acid |
| InChIKey | SIZDUQQDBXJXLQ-SFYZADRCSA-N |
| SMILES | CC(=O)[C@@H]1C[C@@H](C1(C)C)CC(=O)O |
Computed by PubChem (NCBI)