CAS 473253-40-6 appears in our catalog under these names: 3-(4-Methoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95%, 3-(4-Methoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 473253-40-6) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: HSCXSJZYFWHROH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | HSCXSJZYFWHROH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(C2)C(=O)O |
Computed by PubChem (NCBI)