CAS 474398-80-6 is the registry number for 4,6-Dimethoxy-1h-indole-2-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6-dimethoxy-1H-indole-2-carbohydrazide (CAS 474398-80-6) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 4,6-dimethoxy-1H-indole-2-carbohydrazide. InChIKey: QJFXTLCZEVOZTG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4,6-dimethoxy-1H-indole-2-carbohydrazide |
| InChIKey | QJFXTLCZEVOZTG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(N2)C(=O)NN)C(=C1)OC |
Computed by PubChem (NCBI)